C3H7ClO3 — CID 54142459
2,3-dihydroxypropyl hypochlorite (PubChem CID 54142459) has the molecular formula C3H7ClO3 and a molecular weight of 126.54 g/mol. Its IUPAC name is 2,3-dihydroxypropyl hypochlorite.
| Compound Name | 2,3-dihydroxypropyl hypochlorite |
|---|---|
| PubChem CID | 54142459 |
| Molecular Formula | C3H7ClO3 |
| Molecular Weight | 126.54 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | 2,3-dihydroxypropyl hypochlorite |
| SMILES | OCC(O)COCl |
| InChI | InChI=1S/C3H7ClO3/c4-7-2-3(6)1-5/h3,5-6H,1-2H2 |
| InChIKey | OCANCGNUSHKXGR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.54 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |