C7H16O6 — CID 59854090
3-(2,3-dihydroxypropoxymethoxy)propane-1,2-diol (PubChem CID 59854090) has the molecular formula C7H16O6 and a molecular weight of 196.20 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxymethoxy)propane-1,2-diol.
| Compound Name | 3-(2,3-dihydroxypropoxymethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 59854090 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3-(2,3-dihydroxypropoxymethoxy)propane-1,2-diol |
| SMILES | OCC(O)COCOCC(O)CO |
| InChI | InChI=1S/C7H16O6/c8-1-6(10)3-12-5-13-4-7(11)2-9/h6-11H,1-5H2 |
| InChIKey | RFKSRZIDTYVHLY-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|