C11H20F4O8 — CID 59434575
3-[3-(2,3-dihydroxypropoxymethoxymethoxy)-2,2,3,3-tetrafluoropropoxy]propane-1,2-diol (PubChem CID 59434575) has the molecular formula C11H20F4O8 and a molecular weight of 356.27 g/mol. Its IUPAC name is 3-[3-(2,3-dihydroxypropoxymethoxymethoxy)-2,2,3,3-tetrafluoropropoxy]propane-1,2-diol.
| Compound Name | 3-[3-(2,3-dihydroxypropoxymethoxymethoxy)-2,2,3,3-tetrafluoropropoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 59434575 |
| Molecular Formula | C11H20F4O8 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-[3-(2,3-dihydroxypropoxymethoxymethoxy)-2,2,3,3-tetrafluoropropoxy]propane-1,2-diol |
| SMILES | OCC(O)COCOCOC(F)(F)C(F)(F)COCC(O)CO |
| InChI | InChI=1S/C11H20F4O8/c12-10(13,5-20-3-8(18)1-16)11(14,15)23-7-22-6-21-4-9(19)2-17/h8-9,16-19H,1-7H2 |
| InChIKey | RRCCLUCIWKJOPR-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|