C7H10F6O3 — CID 112758141
3-(2,2,3,4,4,4-hexafluorobutoxy)propane-1,2-diol (PubChem CID 112758141) has the molecular formula C7H10F6O3 and a molecular weight of 256.14 g/mol. Its IUPAC name is 3-(2,2,3,4,4,4-hexafluorobutoxy)propane-1,2-diol.
| Compound Name | 3-(2,2,3,4,4,4-hexafluorobutoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 112758141 |
| Molecular Formula | C7H10F6O3 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-(2,2,3,4,4,4-hexafluorobutoxy)propane-1,2-diol |
| SMILES | OCC(O)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6O3/c8-5(7(11,12)13)6(9,10)3-16-2-4(15)1-14/h4-5,14-15H,1-3H2 |
| InChIKey | MYYFNAVWRGBFBC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |