C4H10O3S — CID 87475108
3-(sulfanylmethoxy)propane-1,2-diol (PubChem CID 87475108) has the molecular formula C4H10O3S and a molecular weight of 138.19 g/mol. Its IUPAC name is 3-(sulfanylmethoxy)propane-1,2-diol.
| Compound Name | 3-(sulfanylmethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 87475108 |
| Molecular Formula | C4H10O3S |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 3-(sulfanylmethoxy)propane-1,2-diol |
| SMILES | OCC(O)COCS |
| InChI | InChI=1S/C4H10O3S/c5-1-4(6)2-7-3-8/h4-6,8H,1-3H2 |
| InChIKey | PORRKLZQKGCWMX-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|