C9H20O6S — CID 57044013
3-[2-(2,3-dihydroxypropoxy)-3-sulfanylpropoxy]propane-1,2-diol (PubChem CID 57044013) has the molecular formula C9H20O6S and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroxypropoxy)-3-sulfanylpropoxy]propane-1,2-diol.
| Compound Name | 3-[2-(2,3-dihydroxypropoxy)-3-sulfanylpropoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 57044013 |
| Molecular Formula | C9H20O6S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-[2-(2,3-dihydroxypropoxy)-3-sulfanylpropoxy]propane-1,2-diol |
| SMILES | OCC(O)COCC(CS)OCC(O)CO |
| InChI | InChI=1S/C9H20O6S/c10-1-7(12)3-14-5-9(6-16)15-4-8(13)2-11/h7-13,16H,1-6H2 |
| InChIKey | ICHPDQRSXCBTPF-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|