C21H41Cl3O12 — CID 54196673
3-[1-[2,3-bis[3-chloro-2-(2,3-dihydroxypropoxy)propoxy]propoxy]-3-chloropropan-2-yl]oxypropane-1,2-diol (PubChem CID 54196673) has the molecular formula C21H41Cl3O12 and a molecular weight of 591.91 g/mol. Its IUPAC name is 3-[1-[2,3-bis[3-chloro-2-(2,3-dihydroxypropoxy)propoxy]propoxy]-3-chloropropan-2-yl]oxypropane-1,2-diol.
| Compound Name | 3-[1-[2,3-bis[3-chloro-2-(2,3-dihydroxypropoxy)propoxy]propoxy]-3-chloropropan-2-yl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 54196673 |
| Molecular Formula | C21H41Cl3O12 |
| Molecular Weight | 591.91 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 3-[1-[2,3-bis[3-chloro-2-(2,3-dihydroxypropoxy)propoxy]propoxy]-3-chloropropan-2-yl]oxypropane-1,2-diol |
| SMILES | OCC(O)COC(CCl)COCC(COCC(CCl)OCC(O)CO)OCC(CCl)OCC(O)CO |
| InChI | InChI=1S/C21H41Cl3O12/c22-1-18(33-7-15(28)4-25)10-31-12-21(36-14-20(3-24)35-9-17(30)6-27)13-32-11-19(2-23)34-8-16(29)5-26/h15-21,25-30H,1-14H2 |
| InChIKey | PMHNBQULONTLLD-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.91 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|