C12H28NO6+ — CID 89337640
[3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl]-trimethylazanium (PubChem CID 89337640) has the molecular formula C12H28NO6+ and a molecular weight of 282.36 g/mol. Its IUPAC name is [3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 89337640 |
| Molecular Formula | C12H28NO6+ |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)COCC(O)COCC(O)CO |
| InChI | InChI=1S/C12H28NO6/c1-13(2,3)4-10(15)6-18-8-12(17)9-19-7-11(16)5-14/h10-12,14-17H,4-9H2,1-3H3/q+1 |
| InChIKey | JNXRVOJTIITUPU-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|