C22H50Cl2N2O4 — CID 71623864
[2-hydroxy-3-[10-[2-hydroxy-3-(trimethylazaniumyl)propoxy]decoxy]propyl]-trimethylazanium dichloride (PubChem CID 71623864) has the molecular formula C22H50Cl2N2O4 and a molecular weight of 477.56 g/mol. Its IUPAC name is [2-hydroxy-3-[10-[2-hydroxy-3-(trimethylazaniumyl)propoxy]decoxy]propyl]-trimethylazanium dichloride.
| Compound Name | [2-hydroxy-3-[10-[2-hydroxy-3-(trimethylazaniumyl)propoxy]decoxy]propyl]-trimethylazanium dichloride |
|---|---|
| PubChem CID | 71623864 |
| Molecular Formula | C22H50Cl2N2O4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | [2-hydroxy-3-[10-[2-hydroxy-3-(trimethylazaniumyl)propoxy]decoxy]propyl]-trimethylazanium dichloride |
| SMILES | C[N+](C)(C)CC(O)COCCCCCCCCCCOCC(O)C[N+](C)(C)C.[Cl-].[Cl-] |
| InChI | InChI=1S/C22H50N2O4.2ClH/c1-23(2,3)17-21(25)19-27-15-13-11-9-7-8-10-12-14-16-28-20-22(26)18-24(4,5)6;;/h21-22,25-26H,7-20H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | YICHDTIVEJTESB-UHFFFAOYSA-L |
| XLogP | -3.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|