About (2S)-1-octoxybutan-2-ol
(2S)-1-octoxybutan-2-ol (PubChem CID 88988399) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is (2S)-1-octoxybutan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-octoxybutan-2-ol |
| PubChem CID | 88988399 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | (2S)-1-octoxybutan-2-ol |
| SMILES | CCCCCCCCOC[C@@H](O)CC |
| InChI | InChI=1S/C12H26O2/c1-3-5-6-7-8-9-10-14-11-12(13)4-2/h12-13H,3-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | RFYZIHMISWXPNP-LBPRGKRZSA-N |
| XLogP | 3.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-octoxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-octoxybutan-2-ol?
The IUPAC name of (2S)-1-octoxybutan-2-ol (CID 88988399) is (2S)-1-octoxybutan-2-ol.
What is the SMILES notation for (2S)-1-octoxybutan-2-ol?
The canonical SMILES for (2S)-1-octoxybutan-2-ol is CCCCCCCCOC[C@@H](O)CC.
What is the InChIKey of (2S)-1-octoxybutan-2-ol?
The InChIKey is RFYZIHMISWXPNP-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H26O2/c1-3-5-6-7-8-9-10-14-11-12(13)4-2/h12-13H,3-11H2,1-2H3/t12-/m0/s1.
What are the key properties of (2S)-1-octoxybutan-2-ol?
(2S)-1-octoxybutan-2-ol has a molecular weight of 202.34 g/mol, XLogP of 3.13, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-octoxybutan-2-ol is sourced from PubChem (CID 88988399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).