About methane;1-methoxybutan-2-ol
methane;1-methoxybutan-2-ol (PubChem CID 161499525) has the molecular formula C7H20O2
and a molecular weight of 136.24 g/mol. Its IUPAC name is methane;1-methoxybutan-2-ol.
Molecular Properties
| Compound Name | methane;1-methoxybutan-2-ol |
| PubChem CID | 161499525 |
| Molecular Formula | C7H20O2 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.15 |
| IUPAC Name | methane;1-methoxybutan-2-ol |
| SMILES | C.C.CCC(O)COC |
| InChI | InChI=1S/C5H12O2.2CH4/c1-3-5(6)4-7-2;;/h5-6H,3-4H2,1-2H3;2*1H4 |
| InChIKey | WGQPMGIVGSNPLJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;1-methoxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methoxybutan-2-ol?
The IUPAC name of methane;1-methoxybutan-2-ol (CID 161499525) is methane;1-methoxybutan-2-ol.
What is the SMILES notation for methane;1-methoxybutan-2-ol?
The canonical SMILES for methane;1-methoxybutan-2-ol is C.C.CCC(O)COC.
What is the InChIKey of methane;1-methoxybutan-2-ol?
The InChIKey is WGQPMGIVGSNPLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.2CH4/c1-3-5(6)4-7-2;;/h5-6H,3-4H2,1-2H3;2*1H4.
What are the key properties of methane;1-methoxybutan-2-ol?
methane;1-methoxybutan-2-ol has a molecular weight of 136.24 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methoxybutan-2-ol is sourced from PubChem (CID 161499525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).