About 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane
2-methoxybutane;1-methoxybutan-2-ol;methoxyethane (PubChem CID 158419492) has the molecular formula C13H32O4
and a molecular weight of 252.39 g/mol. Its IUPAC name is 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane.
Molecular Properties
| Compound Name | 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane |
| PubChem CID | 158419492 |
| Molecular Formula | C13H32O4 |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane |
| SMILES | CCC(C)OC.CCC(O)COC.CCOC |
| InChI | InChI=1S/C5H12O2.C5H12O.C3H8O/c1-3-5(6)4-7-2;1-4-5(2)6-3;1-3-4-2/h5-6H,3-4H2,1-2H3;5H,4H2,1-3H3;3H2,1-2H3 |
| InChIKey | HAHXAPATBBMYHN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane?
The IUPAC name of 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane (CID 158419492) is 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane.
What is the SMILES notation for 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane?
The canonical SMILES for 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane is CCC(C)OC.CCC(O)COC.CCOC.
What is the InChIKey of 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane?
The InChIKey is HAHXAPATBBMYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C5H12O.C3H8O/c1-3-5(6)4-7-2;1-4-5(2)6-3;1-3-4-2/h5-6H,3-4H2,1-2H3;5H,4H2,1-3H3;3H2,1-2H3.
What are the key properties of 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane?
2-methoxybutane;1-methoxybutan-2-ol;methoxyethane has a molecular weight of 252.39 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybutane;1-methoxybutan-2-ol;methoxyethane is sourced from PubChem (CID 158419492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).