About methane;2-methoxybutane
methane;2-methoxybutane (PubChem CID 162124465) has the molecular formula C8H24O
and a molecular weight of 136.28 g/mol. Its IUPAC name is methane;2-methoxybutane.
Molecular Properties
| Compound Name | methane;2-methoxybutane |
| PubChem CID | 162124465 |
| Molecular Formula | C8H24O |
| Molecular Weight | 136.28 g/mol |
| Exact Mass | 136.18 |
| IUPAC Name | methane;2-methoxybutane |
| SMILES | C.C.C.CCC(C)OC |
| InChI | InChI=1S/C5H12O.3CH4/c1-4-5(2)6-3;;;/h5H,4H2,1-3H3;3*1H4 |
| InChIKey | ZHVOMSJGRHXDLC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;2-methoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methoxybutane?
The IUPAC name of methane;2-methoxybutane (CID 162124465) is methane;2-methoxybutane.
What is the SMILES notation for methane;2-methoxybutane?
The canonical SMILES for methane;2-methoxybutane is C.C.C.CCC(C)OC.
What is the InChIKey of methane;2-methoxybutane?
The InChIKey is ZHVOMSJGRHXDLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.3CH4/c1-4-5(2)6-3;;;/h5H,4H2,1-3H3;3*1H4.
What are the key properties of methane;2-methoxybutane?
methane;2-methoxybutane has a molecular weight of 136.28 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methoxybutane is sourced from PubChem (CID 162124465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).