About methanol;5-methoxyhexan-3-ol
methanol;5-methoxyhexan-3-ol (PubChem CID 171659791) has the molecular formula C8H20O3
and a molecular weight of 164.24 g/mol. Its IUPAC name is methanol;5-methoxyhexan-3-ol.
Molecular Properties
| Compound Name | methanol;5-methoxyhexan-3-ol |
| PubChem CID | 171659791 |
| Molecular Formula | C8H20O3 |
| Molecular Weight | 164.24 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | methanol;5-methoxyhexan-3-ol |
| SMILES | CCC(O)CC(C)OC.CO |
| InChI | InChI=1S/C7H16O2.CH4O/c1-4-7(8)5-6(2)9-3;1-2/h6-8H,4-5H2,1-3H3;2H,1H3 |
| InChIKey | OPXYDDHARXXULN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;5-methoxyhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;5-methoxyhexan-3-ol?
The IUPAC name of methanol;5-methoxyhexan-3-ol (CID 171659791) is methanol;5-methoxyhexan-3-ol.
What is the SMILES notation for methanol;5-methoxyhexan-3-ol?
The canonical SMILES for methanol;5-methoxyhexan-3-ol is CCC(O)CC(C)OC.CO.
What is the InChIKey of methanol;5-methoxyhexan-3-ol?
The InChIKey is OPXYDDHARXXULN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.CH4O/c1-4-7(8)5-6(2)9-3;1-2/h6-8H,4-5H2,1-3H3;2H,1H3.
What are the key properties of methanol;5-methoxyhexan-3-ol?
methanol;5-methoxyhexan-3-ol has a molecular weight of 164.24 g/mol, XLogP of 0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;5-methoxyhexan-3-ol is sourced from PubChem (CID 171659791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).