C6H14O2 — CID 13427568
(2R,3S)-2-methoxypentan-3-ol (PubChem CID 13427568) has the molecular formula C6H14O2 and a molecular weight of 118.18 g/mol. Its IUPAC name is (2R,3S)-2-methoxypentan-3-ol.
| Compound Name | (2R,3S)-2-methoxypentan-3-ol |
|---|---|
| PubChem CID | 13427568 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | (2R,3S)-2-methoxypentan-3-ol |
| SMILES | CC[C@H](O)[C@@H](C)OC |
| InChI | InChI=1S/C6H14O2/c1-4-6(7)5(2)8-3/h5-7H,4H2,1-3H3/t5-,6+/m1/s1 |
| InChIKey | XIRSUXFZVLKHKX-RITPCOANSA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |