C13H20O2Se — CID 134931525
(3R,4R,5S)-5-methoxy-4-phenylselanylhexan-3-ol (PubChem CID 134931525) has the molecular formula C13H20O2Se and a molecular weight of 287.26 g/mol. Its IUPAC name is (3R,4R,5S)-5-methoxy-4-phenylselanylhexan-3-ol.
| Compound Name | (3R,4R,5S)-5-methoxy-4-phenylselanylhexan-3-ol |
|---|---|
| PubChem CID | 134931525 |
| Molecular Formula | C13H20O2Se |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (3R,4R,5S)-5-methoxy-4-phenylselanylhexan-3-ol |
| SMILES | CC[C@@H](O)[C@@H]([Se]c1ccccc1)[C@H](C)OC |
| InChI | InChI=1S/C13H20O2Se/c1-4-12(14)13(10(2)15-3)16-11-8-6-5-7-9-11/h5-10,12-14H,4H2,1-3H3/t10-,12+,13-/m0/s1 |
| InChIKey | KYEMBVDJFCFKNQ-UHTWSYAYSA-N |
| XLogP | 1.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|