C14H21ClO4Se — CID 10937473
[(2R,3S)-3-chloro-1,1,4,4-tetramethoxybutan-2-yl]selanylbenzene (PubChem CID 10937473) has the molecular formula C14H21ClO4Se and a molecular weight of 367.73 g/mol. Its IUPAC name is [(2R,3S)-3-chloro-1,1,4,4-tetramethoxybutan-2-yl]selanylbenzene.
| Compound Name | [(2R,3S)-3-chloro-1,1,4,4-tetramethoxybutan-2-yl]selanylbenzene |
|---|---|
| PubChem CID | 10937473 |
| Molecular Formula | C14H21ClO4Se |
| Molecular Weight | 367.73 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | [(2R,3S)-3-chloro-1,1,4,4-tetramethoxybutan-2-yl]selanylbenzene |
| SMILES | COC(OC)[C@@H]([Se]c1ccccc1)[C@@H](Cl)C(OC)OC |
| InChI | InChI=1S/C14H21ClO4Se/c1-16-13(17-2)11(15)12(14(18-3)19-4)20-10-8-6-5-7-9-10/h5-9,11-14H,1-4H3/t11-,12+/m1/s1 |
| InChIKey | PBCOABYLLCKGJF-NEPJUHHUSA-N |
| XLogP | 1.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.73 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|