About phenylselanylbenzene;dihydrochloride
phenylselanylbenzene;dihydrochloride (PubChem CID 87206847) has the molecular formula C12H12Cl2Se
and a molecular weight of 306.09 g/mol. Its IUPAC name is phenylselanylbenzene;dihydrochloride.
Molecular Properties
| Compound Name | phenylselanylbenzene;dihydrochloride |
| PubChem CID | 87206847 |
| Molecular Formula | C12H12Cl2Se |
| Molecular Weight | 306.09 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | phenylselanylbenzene;dihydrochloride |
| SMILES | Cl.Cl.c1ccc([Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Se.2ClH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10H;2*1H |
| InChIKey | MPXPLJISVFQEFQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.09 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenylselanylbenzene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylselanylbenzene;dihydrochloride?
The IUPAC name of phenylselanylbenzene;dihydrochloride (CID 87206847) is phenylselanylbenzene;dihydrochloride.
What is the SMILES notation for phenylselanylbenzene;dihydrochloride?
The canonical SMILES for phenylselanylbenzene;dihydrochloride is Cl.Cl.c1ccc([Se]c2ccccc2)cc1.
What is the InChIKey of phenylselanylbenzene;dihydrochloride?
The InChIKey is MPXPLJISVFQEFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Se.2ClH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10H;2*1H.
What are the key properties of phenylselanylbenzene;dihydrochloride?
phenylselanylbenzene;dihydrochloride has a molecular weight of 306.09 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenylselanylbenzene;dihydrochloride is sourced from PubChem (CID 87206847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).