About formaldehyde;phenylselanylbenzene
formaldehyde;phenylselanylbenzene (PubChem CID 174430151) has the molecular formula C25H22OSe2
and a molecular weight of 496.37 g/mol. Its IUPAC name is formaldehyde;phenylselanylbenzene.
Molecular Properties
| Compound Name | formaldehyde;phenylselanylbenzene |
| PubChem CID | 174430151 |
| Molecular Formula | C25H22OSe2 |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | formaldehyde;phenylselanylbenzene |
| SMILES | C=O.c1ccc([Se]c2ccccc2)cc1.c1ccc([Se]c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H10Se.CH2O/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2/h2*1-10H;1H2 |
| InChIKey | IFBWPYBUTBKQHZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;phenylselanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;phenylselanylbenzene?
The IUPAC name of formaldehyde;phenylselanylbenzene (CID 174430151) is formaldehyde;phenylselanylbenzene.
What is the SMILES notation for formaldehyde;phenylselanylbenzene?
The canonical SMILES for formaldehyde;phenylselanylbenzene is C=O.c1ccc([Se]c2ccccc2)cc1.c1ccc([Se]c2ccccc2)cc1.
What is the InChIKey of formaldehyde;phenylselanylbenzene?
The InChIKey is IFBWPYBUTBKQHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10Se.CH2O/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2/h2*1-10H;1H2.
What are the key properties of formaldehyde;phenylselanylbenzene?
formaldehyde;phenylselanylbenzene has a molecular weight of 496.37 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;phenylselanylbenzene is sourced from PubChem (CID 174430151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).