About [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene
[(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene (PubChem CID 15252820) has the molecular formula C16H26O4Se
and a molecular weight of 361.34 g/mol. Its IUPAC name is [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene.
Molecular Properties
| Compound Name | [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene |
| PubChem CID | 15252820 |
| Molecular Formula | C16H26O4Se |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene |
| SMILES | COCCOCO[C@H](C)[C@H]([Se]c1ccccc1)[C@@H](C)OC |
| InChI | InChI=1S/C16H26O4Se/c1-13(18-4)16(21-15-8-6-5-7-9-15)14(2)20-12-19-11-10-17-3/h5-9,13-14,16H,10-12H2,1-4H3/t13-,14-,16-/m1/s1 |
| InChIKey | YIRZBEPZUNKZQT-IIAWOOMASA-N |
| XLogP | 1.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene?
The IUPAC name of [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene (CID 15252820) is [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene.
What is the SMILES notation for [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene?
The canonical SMILES for [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene is COCCOCO[C@H](C)[C@H]([Se]c1ccccc1)[C@@H](C)OC.
What is the InChIKey of [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene?
The InChIKey is YIRZBEPZUNKZQT-IIAWOOMASA-N. The full InChI is InChI=1S/C16H26O4Se/c1-13(18-4)16(21-15-8-6-5-7-9-15)14(2)20-12-19-11-10-17-3/h5-9,13-14,16H,10-12H2,1-4H3/t13-,14-,16-/m1/s1.
What are the key properties of [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene?
[(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene has a molecular weight of 361.34 g/mol, XLogP of 1.87, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R,4R)-2-methoxy-4-(2-methoxyethoxymethoxy)pentan-3-yl]selanylbenzene is sourced from PubChem (CID 15252820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).