C18H39NO9 — CID 87791179
1-(2-methoxyethoxymethoxy)-N,N-bis[1-(2-methoxyethoxymethoxy)ethyl]ethanamine (PubChem CID 87791179) has the molecular formula C18H39NO9 and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-(2-methoxyethoxymethoxy)-N,N-bis[1-(2-methoxyethoxymethoxy)ethyl]ethanamine.
| Compound Name | 1-(2-methoxyethoxymethoxy)-N,N-bis[1-(2-methoxyethoxymethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 87791179 |
| Molecular Formula | C18H39NO9 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 1-(2-methoxyethoxymethoxy)-N,N-bis[1-(2-methoxyethoxymethoxy)ethyl]ethanamine |
| SMILES | COCCOCOC(C)N(C(C)OCOCCOC)C(C)OCOCCOC |
| InChI | InChI=1S/C18H39NO9/c1-16(26-13-23-10-7-20-4)19(17(2)27-14-24-11-8-21-5)18(3)28-15-25-12-9-22-6/h16-18H,7-15H2,1-6H3 |
| InChIKey | COGYAWBWTRAYFZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 86.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|