C10H20O6 — CID 14201885
methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate (PubChem CID 14201885) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate.
| Compound Name | methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate |
|---|---|
| PubChem CID | 14201885 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate |
| SMILES | COCCOCO[C@@H](C)[C@@H](O)CC(=O)OC |
| InChI | InChI=1S/C10H20O6/c1-8(9(11)6-10(12)14-3)16-7-15-5-4-13-2/h8-9,11H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | JFNMDYFNMHFTDV-IUCAKERBSA-N |
| XLogP | -0.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|