methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate

C10H20O6 — CID 14201885

IUPACmethyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate
SMILESCOCCOCO[C@@H](C)[C@@H](O)CC(=O)OC
InChIInChI=1S/C10H20O6/c1-8(9(11)6-10(12)14-3)16-7-15-5-4-13-2/h8-9,11H,4-7H2,1-3H3/t8-,9-/m0/s1
InChIKeyJFNMDYFNMHFTDV-IUCAKERBSA-N
MW236.26 g/mol
LogP-0.06
Rot. Bonds9

About methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate

methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate (PubChem CID 14201885) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate.

Molecular Properties

Compound Namemethyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate
PubChem CID14201885
Molecular FormulaC10H20O6
Molecular Weight236.26 g/mol
Exact Mass236.13
IUPAC Namemethyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate
SMILESCOCCOCO[C@@H](C)[C@@H](O)CC(=O)OC
InChIInChI=1S/C10H20O6/c1-8(9(11)6-10(12)14-3)16-7-15-5-4-13-2/h8-9,11H,4-7H2,1-3H3/t8-,9-/m0/s1
InChIKeyJFNMDYFNMHFTDV-IUCAKERBSA-N
XLogP-0.06
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.26
LogP ≤ 5-0.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate?
The IUPAC name of methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate (CID 14201885) is methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate.
What is the SMILES notation for methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate?
The canonical SMILES for methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate is COCCOCO[C@@H](C)[C@@H](O)CC(=O)OC.
What is the InChIKey of methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate?
The InChIKey is JFNMDYFNMHFTDV-IUCAKERBSA-N. The full InChI is InChI=1S/C10H20O6/c1-8(9(11)6-10(12)14-3)16-7-15-5-4-13-2/h8-9,11H,4-7H2,1-3H3/t8-,9-/m0/s1.
What are the key properties of methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate?
methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate has a molecular weight of 236.26 g/mol, XLogP of -0.06, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,4S)-3-hydroxy-4-(2-methoxyethoxymethoxy)pentanoate is sourced from PubChem (CID 14201885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).