C12H27NO6 — CID 22340887
1-(methoxymethoxy)-N,N-bis[1-(methoxymethoxy)ethyl]ethanamine (PubChem CID 22340887) has the molecular formula C12H27NO6 and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-(methoxymethoxy)-N,N-bis[1-(methoxymethoxy)ethyl]ethanamine.
| Compound Name | 1-(methoxymethoxy)-N,N-bis[1-(methoxymethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 22340887 |
| Molecular Formula | C12H27NO6 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-(methoxymethoxy)-N,N-bis[1-(methoxymethoxy)ethyl]ethanamine |
| SMILES | COCOC(C)N(C(C)OCOC)C(C)OCOC |
| InChI | InChI=1S/C12H27NO6/c1-10(17-7-14-4)13(11(2)18-8-15-5)12(3)19-9-16-6/h10-12H,7-9H2,1-6H3 |
| InChIKey | GOGLMOHIHGLBIA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|