(2R)-2-(methoxymethoxy)propanoic acid

C5H10O4 — CID 10844423

IUPAC(2R)-2-(methoxymethoxy)propanoic acid
SMILESCOCO[C@H](C)C(=O)O
InChIInChI=1S/C5H10O4/c1-4(5(6)7)9-3-8-2/h4H,3H2,1-2H3,(H,6,7)/t4-/m1/s1
InChIKeySCDDPXCTSGNPLZ-SCSAIBSYSA-N
MW134.13 g/mol
LogP0.08
Rot. Bonds4

About (2R)-2-(methoxymethoxy)propanoic acid

(2R)-2-(methoxymethoxy)propanoic acid (PubChem CID 10844423) has the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. Its IUPAC name is (2R)-2-(methoxymethoxy)propanoic acid.

Molecular Properties

Compound Name(2R)-2-(methoxymethoxy)propanoic acid
PubChem CID10844423
Molecular FormulaC5H10O4
Molecular Weight134.13 g/mol
Exact Mass134.06
IUPAC Name(2R)-2-(methoxymethoxy)propanoic acid
SMILESCOCO[C@H](C)C(=O)O
InChIInChI=1S/C5H10O4/c1-4(5(6)7)9-3-8-2/h4H,3H2,1-2H3,(H,6,7)/t4-/m1/s1
InChIKeySCDDPXCTSGNPLZ-SCSAIBSYSA-N
XLogP0.08
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.13
LogP ≤ 50.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze (2R)-2-(methoxymethoxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(methoxymethoxy)propanoic acid?
The IUPAC name of (2R)-2-(methoxymethoxy)propanoic acid (CID 10844423) is (2R)-2-(methoxymethoxy)propanoic acid.
What is the SMILES notation for (2R)-2-(methoxymethoxy)propanoic acid?
The canonical SMILES for (2R)-2-(methoxymethoxy)propanoic acid is COCO[C@H](C)C(=O)O.
What is the InChIKey of (2R)-2-(methoxymethoxy)propanoic acid?
The InChIKey is SCDDPXCTSGNPLZ-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H10O4/c1-4(5(6)7)9-3-8-2/h4H,3H2,1-2H3,(H,6,7)/t4-/m1/s1.
What are the key properties of (2R)-2-(methoxymethoxy)propanoic acid?
(2R)-2-(methoxymethoxy)propanoic acid has a molecular weight of 134.13 g/mol, XLogP of 0.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(methoxymethoxy)propanoic acid is sourced from PubChem (CID 10844423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).