C8H18O6 — CID 11063695
(2R,3R)-2,3-bis(methoxymethoxy)butane-1,4-diol (PubChem CID 11063695) has the molecular formula C8H18O6 and a molecular weight of 210.23 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(methoxymethoxy)butane-1,4-diol.
| Compound Name | (2R,3R)-2,3-bis(methoxymethoxy)butane-1,4-diol |
|---|---|
| PubChem CID | 11063695 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2R,3R)-2,3-bis(methoxymethoxy)butane-1,4-diol |
| SMILES | COCO[C@H](CO)[C@@H](CO)OCOC |
| InChI | InChI=1S/C8H18O6/c1-11-5-13-7(3-9)8(4-10)14-6-12-2/h7-10H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | XVLLHXOANNRBLV-HTQZYQBOSA-N |
| XLogP | -1.05 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|