C8H18O3 — CID 101465372
(3S,4S)-4-(methoxymethoxy)-3-methylpentan-1-ol (PubChem CID 101465372) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is (3S,4S)-4-(methoxymethoxy)-3-methylpentan-1-ol.
| Compound Name | (3S,4S)-4-(methoxymethoxy)-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 101465372 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (3S,4S)-4-(methoxymethoxy)-3-methylpentan-1-ol |
| SMILES | COCO[C@@H](C)[C@@H](C)CCO |
| InChI | InChI=1S/C8H18O3/c1-7(4-5-9)8(2)11-6-10-3/h7-9H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | IPHBVMNHGZZQLG-YUMQZZPRSA-N |
| XLogP | 1.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|