About (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol
(2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol (PubChem CID 101370806) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol.
Molecular Properties
| Compound Name | (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol |
| PubChem CID | 101370806 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol |
| SMILES | CC[C@@H](O)[C@@H](C)C(OC)OC |
| InChI | InChI=1S/C8H18O3/c1-5-7(9)6(2)8(10-3)11-4/h6-9H,5H2,1-4H3/t6-,7-/m1/s1 |
| InChIKey | CYMIRGRXUOHHKN-RNFRBKRXSA-N |
| XLogP | 1.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol?
The IUPAC name of (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol (CID 101370806) is (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol.
What is the SMILES notation for (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol?
The canonical SMILES for (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol is CC[C@@H](O)[C@@H](C)C(OC)OC.
What is the InChIKey of (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol?
The InChIKey is CYMIRGRXUOHHKN-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H18O3/c1-5-7(9)6(2)8(10-3)11-4/h6-9H,5H2,1-4H3/t6-,7-/m1/s1.
What are the key properties of (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol?
(2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol has a molecular weight of 162.23 g/mol, XLogP of 1.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-1,1-dimethoxy-2-methylpentan-3-ol is sourced from PubChem (CID 101370806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).