C8H18O4 — CID 162402913
(2R,3R)-1,1-dimethoxy-4-methylpentane-2,3-diol (PubChem CID 162402913) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2R,3R)-1,1-dimethoxy-4-methylpentane-2,3-diol.
| Compound Name | (2R,3R)-1,1-dimethoxy-4-methylpentane-2,3-diol |
|---|---|
| PubChem CID | 162402913 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (2R,3R)-1,1-dimethoxy-4-methylpentane-2,3-diol |
| SMILES | COC(OC)[C@H](O)[C@H](O)C(C)C |
| InChI | InChI=1S/C8H18O4/c1-5(2)6(9)7(10)8(11-3)12-4/h5-10H,1-4H3/t6-,7-/m1/s1 |
| InChIKey | SUZWBWMXUWRPAE-RNFRBKRXSA-N |
| XLogP | -0.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|