About (2S,3R)-2,3-dimethoxybutane-1,4-diol
(2S,3R)-2,3-dimethoxybutane-1,4-diol (PubChem CID 119097957) has the molecular formula C6H14O4
and a molecular weight of 150.17 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethoxybutane-1,4-diol.
Molecular Properties
| Compound Name | (2S,3R)-2,3-dimethoxybutane-1,4-diol |
| PubChem CID | 119097957 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | (2S,3R)-2,3-dimethoxybutane-1,4-diol |
| SMILES | CO[C@@H](CO)[C@@H](CO)OC |
| InChI | InChI=1S/C6H14O4/c1-9-5(3-7)6(4-8)10-2/h5-8H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | NGYWQOYLCHMYOO-OLQVQODUSA-N |
| XLogP | -1.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,3R)-2,3-dimethoxybutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2,3-dimethoxybutane-1,4-diol?
The IUPAC name of (2S,3R)-2,3-dimethoxybutane-1,4-diol (CID 119097957) is (2S,3R)-2,3-dimethoxybutane-1,4-diol.
What is the SMILES notation for (2S,3R)-2,3-dimethoxybutane-1,4-diol?
The canonical SMILES for (2S,3R)-2,3-dimethoxybutane-1,4-diol is CO[C@@H](CO)[C@@H](CO)OC.
What is the InChIKey of (2S,3R)-2,3-dimethoxybutane-1,4-diol?
The InChIKey is NGYWQOYLCHMYOO-OLQVQODUSA-N. The full InChI is InChI=1S/C6H14O4/c1-9-5(3-7)6(4-8)10-2/h5-8H,3-4H2,1-2H3/t5-,6+.
What are the key properties of (2S,3R)-2,3-dimethoxybutane-1,4-diol?
(2S,3R)-2,3-dimethoxybutane-1,4-diol has a molecular weight of 150.17 g/mol, XLogP of -1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2,3-dimethoxybutane-1,4-diol is sourced from PubChem (CID 119097957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).