C6H14O4 — CID 119097957
(2S,3R)-2,3-dimethoxybutane-1,4-diol (PubChem CID 119097957) has the molecular formula C6H14O4 and a molecular weight of 150.17 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethoxybutane-1,4-diol.
| Compound Name | (2S,3R)-2,3-dimethoxybutane-1,4-diol |
|---|---|
| PubChem CID | 119097957 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | (2S,3R)-2,3-dimethoxybutane-1,4-diol |
| SMILES | CO[C@@H](CO)[C@@H](CO)OC |
| InChI | InChI=1S/C6H14O4/c1-9-5(3-7)6(4-8)10-2/h5-8H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | NGYWQOYLCHMYOO-OLQVQODUSA-N |
| XLogP | -1.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |