C6H13HgIO3 — CID 6102046
(4-hydroxy-2,3-dimethoxybutyl)-iodomercury (PubChem CID 6102046) has the molecular formula C6H13HgIO3 and a molecular weight of 460.66 g/mol. Its IUPAC name is (4-hydroxy-2,3-dimethoxybutyl)-iodomercury.
| Compound Name | (4-hydroxy-2,3-dimethoxybutyl)-iodomercury |
|---|---|
| PubChem CID | 6102046 |
| Molecular Formula | C6H13HgIO3 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | (4-hydroxy-2,3-dimethoxybutyl)-iodomercury |
| SMILES | COC(CO)C(C[Hg]I)OC |
| InChI | InChI=1S/C6H13O3.Hg.HI/c1-5(8-2)6(4-7)9-3;;/h5-7H,1,4H2,2-3H3;;1H/q;+1;/p-1 |
| InChIKey | NSBRWTUTMCAZBR-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|