C9H20O5 — CID 71440340
2,3,4-trimethoxyhexane-1,5-diol (PubChem CID 71440340) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is 2,3,4-trimethoxyhexane-1,5-diol.
| Compound Name | 2,3,4-trimethoxyhexane-1,5-diol |
|---|---|
| PubChem CID | 71440340 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,3,4-trimethoxyhexane-1,5-diol |
| SMILES | COC(CO)C(OC)C(OC)C(C)O |
| InChI | InChI=1S/C9H20O5/c1-6(11)8(13-3)9(14-4)7(5-10)12-2/h6-11H,5H2,1-4H3 |
| InChIKey | WVZJLXSDXMPTLB-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |