C7H16O6 — CID 22214433
(2R,3R,4R,5R)-4-methoxyhexane-1,2,3,5,6-pentol (PubChem CID 22214433) has the molecular formula C7H16O6 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-methoxyhexane-1,2,3,5,6-pentol.
| Compound Name | (2R,3R,4R,5R)-4-methoxyhexane-1,2,3,5,6-pentol |
|---|---|
| PubChem CID | 22214433 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2R,3R,4R,5R)-4-methoxyhexane-1,2,3,5,6-pentol |
| SMILES | CO[C@@H]([C@H](O)[C@H](O)CO)[C@H](O)CO |
| InChI | InChI=1S/C7H16O6/c1-13-7(5(11)3-9)6(12)4(10)2-8/h4-12H,2-3H2,1H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | BANUITVRCYACKI-DBRKOABJSA-N |
| XLogP | -2.93 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |