C8H16O6 — CID 14259031
3,5,6-trihydroxy-2,4-dimethoxyhexanal (PubChem CID 14259031) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is 3,5,6-trihydroxy-2,4-dimethoxyhexanal.
| Compound Name | 3,5,6-trihydroxy-2,4-dimethoxyhexanal |
|---|---|
| PubChem CID | 14259031 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 3,5,6-trihydroxy-2,4-dimethoxyhexanal |
| SMILES | COC(C=O)C(O)C(OC)C(O)CO |
| InChI | InChI=1S/C8H16O6/c1-13-6(4-10)7(12)8(14-2)5(11)3-9/h4-9,11-12H,3H2,1-2H3 |
| InChIKey | UITMJPZVJJKFBV-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|