C7H13FO5 — CID 87895120
(2R,3R,4R,5R)-4-fluoro-3,5,6-trihydroxy-2-methoxyhexanal (PubChem CID 87895120) has the molecular formula C7H13FO5 and a molecular weight of 196.17 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-fluoro-3,5,6-trihydroxy-2-methoxyhexanal.
| Compound Name | (2R,3R,4R,5R)-4-fluoro-3,5,6-trihydroxy-2-methoxyhexanal |
|---|---|
| PubChem CID | 87895120 |
| Molecular Formula | C7H13FO5 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2R,3R,4R,5R)-4-fluoro-3,5,6-trihydroxy-2-methoxyhexanal |
| SMILES | CO[C@@H](C=O)[C@@H](O)[C@H](F)[C@H](O)CO |
| InChI | InChI=1S/C7H13FO5/c1-13-5(3-10)7(12)6(8)4(11)2-9/h3-7,9,11-12H,2H2,1H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | OHBSMMFGFQLCPF-XZBKPIIZSA-N |
| XLogP | -1.75 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|