C6H13FO5 — CID 139026044
(2S,3R,4R,5S)-4-fluorohexane-1,2,3,5,6-pentol (PubChem CID 139026044) has the molecular formula C6H13FO5 and a molecular weight of 184.16 g/mol. Its IUPAC name is (2S,3R,4R,5S)-4-fluorohexane-1,2,3,5,6-pentol.
| Compound Name | (2S,3R,4R,5S)-4-fluorohexane-1,2,3,5,6-pentol |
|---|---|
| PubChem CID | 139026044 |
| Molecular Formula | C6H13FO5 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2S,3R,4R,5S)-4-fluorohexane-1,2,3,5,6-pentol |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](F)[C@@H](O)CO |
| InChI | InChI=1S/C6H13FO5/c7-5(3(10)1-8)6(12)4(11)2-9/h3-6,8-12H,1-2H2/t3-,4-,5+,6+/m0/s1 |
| InChIKey | ZEGLBRXQLUKRML-UNTFVMJOSA-N |
| XLogP | -2.61 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |