C14H28O10 — CID 89155701
(4R,5R,6S)-4-methoxy-6-methyloxane-2,5-diol;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-methoxyhexanal (PubChem CID 89155701) has the molecular formula C14H28O10 and a molecular weight of 356.37 g/mol. Its IUPAC name is (4R,5R,6S)-4-methoxy-6-methyloxane-2,5-diol;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-methoxyhexanal.
| Compound Name | (4R,5R,6S)-4-methoxy-6-methyloxane-2,5-diol;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-methoxyhexanal |
|---|---|
| PubChem CID | 89155701 |
| Molecular Formula | C14H28O10 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (4R,5R,6S)-4-methoxy-6-methyloxane-2,5-diol;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-methoxyhexanal |
| SMILES | CO[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO.CO[C@@H]1CC(O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C7H14O6.C7H14O4/c1-13-5(3-9)7(12)6(11)4(10)2-8;1-4-7(9)5(10-2)3-6(8)11-4/h3-8,10-12H,2H2,1H3;4-9H,3H2,1-2H3/t4-,5+,6-,7-;4-,5+,6?,7+/m10/s1 |
| InChIKey | WQTSJFJNLIUBEN-ACZUABCTSA-N |
| XLogP | -3.24 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|