C6H12O5 — CID 21126151
(2R,3S,4R)-2,4,5-trihydroxy-3-methoxypentanal (PubChem CID 21126151) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is (2R,3S,4R)-2,4,5-trihydroxy-3-methoxypentanal.
| Compound Name | (2R,3S,4R)-2,4,5-trihydroxy-3-methoxypentanal |
|---|---|
| PubChem CID | 21126151 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (2R,3S,4R)-2,4,5-trihydroxy-3-methoxypentanal |
| SMILES | CO[C@@H]([C@H](O)CO)[C@@H](O)C=O |
| InChI | InChI=1S/C6H12O5/c1-11-6(4(9)2-7)5(10)3-8/h2,4-6,8-10H,3H2,1H3/t4-,5+,6+/m0/s1 |
| InChIKey | JNAZNWGFTWHNTH-KVQBGUIXSA-N |
| XLogP | -2.09 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|