C9H18O6 — CID 135149067
(2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-propan-2-yloxyhexanal (PubChem CID 135149067) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-propan-2-yloxyhexanal.
| Compound Name | (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-propan-2-yloxyhexanal |
|---|---|
| PubChem CID | 135149067 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-propan-2-yloxyhexanal |
| SMILES | CC(C)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)C=O |
| InChI | InChI=1S/C9H18O6/c1-5(2)15-9(7(13)4-11)8(14)6(12)3-10/h4-10,12-14H,3H2,1-2H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | KQHLNKVAQTWFMO-BZNPZCIMSA-N |
| XLogP | -1.95 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|