C10H20O6 — CID 118394063
(2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-[(2-methylpropan-2-yl)oxy]hexanal (PubChem CID 118394063) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-[(2-methylpropan-2-yl)oxy]hexanal.
| Compound Name | (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-[(2-methylpropan-2-yl)oxy]hexanal |
|---|---|
| PubChem CID | 118394063 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-[(2-methylpropan-2-yl)oxy]hexanal |
| SMILES | CC(C)(C)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)C=O |
| InChI | InChI=1S/C10H20O6/c1-10(2,3)16-9(7(14)5-12)8(15)6(13)4-11/h5-9,11,13-15H,4H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | JTFWZCXVGGYGJZ-BZNPZCIMSA-N |
| XLogP | -1.56 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|