C6H11N3O6 — CID 87504241
(2R,3S,4S,5R)-3-azidooxy-2,4,5,6-tetrahydroxyhexanal (PubChem CID 87504241) has the molecular formula C6H11N3O6 and a molecular weight of 221.17 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-azidooxy-2,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2R,3S,4S,5R)-3-azidooxy-2,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 87504241 |
| Molecular Formula | C6H11N3O6 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (2R,3S,4S,5R)-3-azidooxy-2,4,5,6-tetrahydroxyhexanal |
| SMILES | [N-]=[N+]=NO[C@@H]([C@@H](O)[C@H](O)CO)[C@@H](O)C=O |
| InChI | InChI=1S/C6H11N3O6/c7-8-9-15-6(4(13)2-11)5(14)3(12)1-10/h2-6,10,12-14H,1H2/t3-,4+,5+,6-/m1/s1 |
| InChIKey | HLLJJKZCXUXFGU-DPYQTVNSSA-N |
| XLogP | -2.13 |
| TPSA | 155.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|