C6H13N3O6 — CID 87344768
CID 87344768 (PubChem CID 87344768) has the molecular formula C6H13N3O6 and a molecular weight of 223.19 g/mol.
| Compound Name | CID 87344768 |
|---|---|
| PubChem CID | 87344768 |
| Molecular Formula | C6H13N3O6 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | — |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO.[N-]=[N+]=N |
| InChI | InChI=1S/C6H12O6.HN3/c7-1-3(9)5(11)6(12)4(10)2-8;1-3-2/h1,3-6,8-12H,2H2;1H/t3-,4+,5+,6-;/m0./s1 |
| InChIKey | FUTGRELDERWIQW-NQZVPSPJSA-N |
| XLogP | -2.50 |
| TPSA | 178.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|