C8H16O6 — CID 175587172
2,4,5,6-tetrahydroxy-3-methoxyheptanal (PubChem CID 175587172) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2,4,5,6-tetrahydroxy-3-methoxyheptanal.
| Compound Name | 2,4,5,6-tetrahydroxy-3-methoxyheptanal |
|---|---|
| PubChem CID | 175587172 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2,4,5,6-tetrahydroxy-3-methoxyheptanal |
| SMILES | COC(C(O)C=O)C(O)C(O)C(C)O |
| InChI | InChI=1S/C8H16O6/c1-4(10)6(12)7(13)8(14-2)5(11)3-9/h3-8,10-13H,1-2H3 |
| InChIKey | LWWGWZIYBRUQBI-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|