C6H12O5 — CID 131953208
(2S,3R,4R,5S)-2,3,4,5-tetrahydroxy(1,2,3,4,5,6-13C6)hexanal (PubChem CID 131953208) has the molecular formula C6H12O5 and a molecular weight of 170.11 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2,3,4,5-tetrahydroxy(1,2,3,4,5,6-13C6)hexanal.
| Compound Name | (2S,3R,4R,5S)-2,3,4,5-tetrahydroxy(1,2,3,4,5,6-13C6)hexanal |
|---|---|
| PubChem CID | 131953208 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 170.11 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2S,3R,4R,5S)-2,3,4,5-tetrahydroxy(1,2,3,4,5,6-13C6)hexanal |
| SMILES | [13CH3][13C@H](O)[13C@@H](O)[13C@@H](O)[13C@H](O)[13CH]=O |
| InChI | InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4+,5+,6-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | PNNNRSAQSRJVSB-CPRVWCQRSA-N |
| XLogP | -2.35 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.11 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|