C9H16O7 — CID 87837698
[(2R,3R,4S)-1,2,4-trihydroxy-5-oxopentan-3-yl] 2-hydroxybutanoate (PubChem CID 87837698) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is [(2R,3R,4S)-1,2,4-trihydroxy-5-oxopentan-3-yl] 2-hydroxybutanoate.
| Compound Name | [(2R,3R,4S)-1,2,4-trihydroxy-5-oxopentan-3-yl] 2-hydroxybutanoate |
|---|---|
| PubChem CID | 87837698 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | [(2R,3R,4S)-1,2,4-trihydroxy-5-oxopentan-3-yl] 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)O[C@@H]([C@H](O)C=O)[C@H](O)CO |
| InChI | InChI=1S/C9H16O7/c1-2-5(12)9(15)16-8(6(13)3-10)7(14)4-11/h3,5-8,11-14H,2,4H2,1H3/t5?,6-,7-,8+/m1/s1 |
| InChIKey | QORITESXWUFVRM-IDWMTUBTSA-N |
| XLogP | -2.42 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|