C12H22O8 — CID 102116279
[(2R,3S,4S,5S)-1,2,5,6-tetrahydroxy-4-propanoyloxyhexan-3-yl] propanoate (PubChem CID 102116279) has the molecular formula C12H22O8 and a molecular weight of 294.30 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-1,2,5,6-tetrahydroxy-4-propanoyloxyhexan-3-yl] propanoate.
| Compound Name | [(2R,3S,4S,5S)-1,2,5,6-tetrahydroxy-4-propanoyloxyhexan-3-yl] propanoate |
|---|---|
| PubChem CID | 102116279 |
| Molecular Formula | C12H22O8 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [(2R,3S,4S,5S)-1,2,5,6-tetrahydroxy-4-propanoyloxyhexan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]([C@@H](OC(=O)CC)[C@@H](O)CO)[C@H](O)CO |
| InChI | InChI=1S/C12H22O8/c1-3-9(17)19-11(7(15)5-13)12(8(16)6-14)20-10(18)4-2/h7-8,11-16H,3-6H2,1-2H3/t7-,8+,11-,12-/m0/s1 |
| InChIKey | GHJMGMJPOAQJFU-VVJJBPBLSA-N |
| XLogP | -1.66 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |