C11H18O8 — CID 87698863
[(2R,3S,4R,5R)-3-acetyloxy-4,5,6-trihydroxy-1-oxohexan-2-yl] propanoate (PubChem CID 87698863) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-acetyloxy-4,5,6-trihydroxy-1-oxohexan-2-yl] propanoate.
| Compound Name | [(2R,3S,4R,5R)-3-acetyloxy-4,5,6-trihydroxy-1-oxohexan-2-yl] propanoate |
|---|---|
| PubChem CID | 87698863 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | [(2R,3S,4R,5R)-3-acetyloxy-4,5,6-trihydroxy-1-oxohexan-2-yl] propanoate |
| SMILES | CCC(=O)O[C@@H](C=O)[C@@H](OC(C)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H18O8/c1-3-9(16)19-8(5-13)11(18-6(2)14)10(17)7(15)4-12/h5,7-8,10-12,15,17H,3-4H2,1-2H3/t7-,8+,10-,11-/m1/s1 |
| InChIKey | OAHWONUPZFSEHK-JZSSXWJLSA-N |
| XLogP | -1.85 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|