C10H18N2O8 — CID 91155465
[(2R,3S,4R,5R)-3-(2-aminoacetyl)oxy-4,5,6-trihydroxy-1-oxohexan-2-yl] 2-aminoacetate (PubChem CID 91155465) has the molecular formula C10H18N2O8 and a molecular weight of 294.26 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-(2-aminoacetyl)oxy-4,5,6-trihydroxy-1-oxohexan-2-yl] 2-aminoacetate.
| Compound Name | [(2R,3S,4R,5R)-3-(2-aminoacetyl)oxy-4,5,6-trihydroxy-1-oxohexan-2-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 91155465 |
| Molecular Formula | C10H18N2O8 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | [(2R,3S,4R,5R)-3-(2-aminoacetyl)oxy-4,5,6-trihydroxy-1-oxohexan-2-yl] 2-aminoacetate |
| SMILES | NCC(=O)O[C@@H]([C@H](O)[C@H](O)CO)[C@H](C=O)OC(=O)CN |
| InChI | InChI=1S/C10H18N2O8/c11-1-7(16)19-6(4-14)10(20-8(17)2-12)9(18)5(15)3-13/h4-6,9-10,13,15,18H,1-3,11-12H2/t5-,6+,9-,10-/m1/s1 |
| InChIKey | BXLVJDIGTDCGNB-MLTZYSBQSA-N |
| XLogP | -4.36 |
| TPSA | 182.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|