C7H13NO7 — CID 87990726
[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] carbamate (PubChem CID 87990726) has the molecular formula C7H13NO7 and a molecular weight of 223.18 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] carbamate.
| Compound Name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] carbamate |
|---|---|
| PubChem CID | 87990726 |
| Molecular Formula | C7H13NO7 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] carbamate |
| SMILES | NC(=O)O[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H13NO7/c8-7(14)15-4(2-10)6(13)5(12)3(11)1-9/h2-6,9,11-13H,1H2,(H2,8,14)/t3-,4+,5-,6-/m1/s1 |
| InChIKey | RPAPPKLPEULVCK-JGWLITMVSA-N |
| XLogP | -3.28 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|