C10H18O10 — CID 87662702
[(2R,3R)-3,4-dihydroxy-1-oxobutan-2-yl] (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 87662702) has the molecular formula C10H18O10 and a molecular weight of 298.24 g/mol. Its IUPAC name is [(2R,3R)-3,4-dihydroxy-1-oxobutan-2-yl] (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [(2R,3R)-3,4-dihydroxy-1-oxobutan-2-yl] (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 87662702 |
| Molecular Formula | C10H18O10 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | [(2R,3R)-3,4-dihydroxy-1-oxobutan-2-yl] (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C[C@H](OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)[C@H](O)CO |
| InChI | InChI=1S/C10H18O10/c11-1-4(14)6(3-13)20-10(19)9(18)8(17)7(16)5(15)2-12/h3-9,11-12,14-18H,1-2H2/t4-,5-,6+,7+,8+,9-/m1/s1 |
| InChIKey | SEUKGUMEVSCCKC-PZJMJUOOSA-N |
| XLogP | -5.11 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|