C7H16O9P+ — CID 87367328
dihydroxy-methyl-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyphosphanium (PubChem CID 87367328) has the molecular formula C7H16O9P+ and a molecular weight of 275.17 g/mol. Its IUPAC name is dihydroxy-methyl-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyphosphanium.
| Compound Name | dihydroxy-methyl-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyphosphanium |
|---|---|
| PubChem CID | 87367328 |
| Molecular Formula | C7H16O9P+ |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | dihydroxy-methyl-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyphosphanium |
| SMILES | C[P+](O)(O)OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H16O9P/c1-17(14,15)16-7(13)6(12)5(11)4(10)3(9)2-8/h3-6,8-12,14-15H,2H2,1H3/q+1/t3-,4-,5+,6-/m1/s1 |
| InChIKey | VVQDYRSIMDZCFA-ARQDHWQXSA-N |
| XLogP | -3.66 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|